About 1,4,5-trimethylnaphthalene
1,4,5-trimethylnaphthalene (PubChem CID 16478) has the molecular formula C13H14
and a molecular weight of 170.25 g/mol. Its IUPAC name is 1,4,5-trimethylnaphthalene.
Molecular Properties
| Compound Name | 1,4,5-trimethylnaphthalene |
| PubChem CID | 16478 |
| Molecular Formula | C13H14 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 1,4,5-trimethylnaphthalene |
| SMILES | Cc1ccc(C)c2c(C)cccc12 |
| InChI | InChI=1S/C13H14/c1-9-7-8-11(3)13-10(2)5-4-6-12(9)13/h4-8H,1-3H3 |
| InChIKey | FSAWRQYDMHSDRN-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,4,5-trimethylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4,5-trimethylnaphthalene?
The IUPAC name of 1,4,5-trimethylnaphthalene (CID 16478) is 1,4,5-trimethylnaphthalene.
What is the SMILES notation for 1,4,5-trimethylnaphthalene?
The canonical SMILES for 1,4,5-trimethylnaphthalene is Cc1ccc(C)c2c(C)cccc12.
What is the InChIKey of 1,4,5-trimethylnaphthalene?
The InChIKey is FSAWRQYDMHSDRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14/c1-9-7-8-11(3)13-10(2)5-4-6-12(9)13/h4-8H,1-3H3.
What are the key properties of 1,4,5-trimethylnaphthalene?
1,4,5-trimethylnaphthalene has a molecular weight of 170.25 g/mol, XLogP of 3.77, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4,5-trimethylnaphthalene is sourced from PubChem (CID 16478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).