C31H23N2OP — CID 164780049
9,9-dimethyl-17-phenyl-4,5-diaza-17λ5-phosphahexacyclo[16.8.0.02,10.03,8.011,16.021,26]hexacosa-1(18),2(10),3(8),4,6,11,13,15,19,21,23,25-dodecaene 17-oxide (PubChem CID 164780049) has the molecular formula C31H23N2OP and a molecular weight of 470.51 g/mol. Its IUPAC name is 9,9-dimethyl-17-phenyl-4,5-diaza-17λ5-phosphahexacyclo[16.8.0.02,10.03,8.011,16.021,26]hexacosa-1(18),2(10),3(8),4,6,11,13,15,19,21,23,25-dodecaene 17-oxide.
| Compound Name | 9,9-dimethyl-17-phenyl-4,5-diaza-17λ5-phosphahexacyclo[16.8.0.02,10.03,8.011,16.021,26]hexacosa-1(18),2(10),3(8),4,6,11,13,15,19,21,23,25-dodecaene 17-oxide |
|---|---|
| PubChem CID | 164780049 |
| Molecular Formula | C31H23N2OP |
| Molecular Weight | 470.51 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | 9,9-dimethyl-17-phenyl-4,5-diaza-17λ5-phosphahexacyclo[16.8.0.02,10.03,8.011,16.021,26]hexacosa-1(18),2(10),3(8),4,6,11,13,15,19,21,23,25-dodecaene 17-oxide |
| SMILES | CC1(C)C2=C(c3nnccc31)c1c(ccc3ccccc13)P(=O)(c1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C31H23N2OP/c1-31(2)24-18-19-32-33-30(24)28-27-22-13-7-6-10-20(22)16-17-26(27)35(34,21-11-4-3-5-12-21)25-15-9-8-14-23(25)29(28)31/h3-19H,1-2H3 |
| InChIKey | WFJUHDQXVQULHD-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.51 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|