C21H29N5O4 — CID 164780151
tert-butyl (3S)-3-[3-ethynyl-4-isocyano-5-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pyrazol-1-yl]pyrrolidine-1-carboxylate (PubChem CID 164780151) has the molecular formula C21H29N5O4 and a molecular weight of 415.49 g/mol. Its IUPAC name is tert-butyl (3S)-3-[3-ethynyl-4-isocyano-5-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pyrazol-1-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[3-ethynyl-4-isocyano-5-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pyrazol-1-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 164780151 |
| Molecular Formula | C21H29N5O4 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | tert-butyl (3S)-3-[3-ethynyl-4-isocyano-5-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pyrazol-1-yl]pyrrolidine-1-carboxylate |
| SMILES | [C-]#[N+]c1c(C#C)nn([C@H]2CCN(C(=O)OC(C)(C)C)C2)c1N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H29N5O4/c1-10-15-16(22-8)17(24(9)18(27)29-20(2,3)4)26(23-15)14-11-12-25(13-14)19(28)30-21(5,6)7/h1,14H,11-13H2,2-7,9H3/t14-/m0/s1 |
| InChIKey | MHVIDEMGAMCGJB-AWEZNQCLSA-N |
| XLogP | 3.97 |
| TPSA | 81.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|