C19H15F2N5O — CID 164780337
(4,4-difluoropiperidin-1-yl)-[1-(6-isocyano-3-pyridinyl)pyrrolo[2,3-b]pyridin-5-yl]methanone (PubChem CID 164780337) has the molecular formula C19H15F2N5O and a molecular weight of 367.36 g/mol. Its IUPAC name is (4,4-difluoropiperidin-1-yl)-[1-(6-isocyano-3-pyridinyl)pyrrolo[2,3-b]pyridin-5-yl]methanone.
| Compound Name | (4,4-difluoropiperidin-1-yl)-[1-(6-isocyano-3-pyridinyl)pyrrolo[2,3-b]pyridin-5-yl]methanone |
|---|---|
| PubChem CID | 164780337 |
| Molecular Formula | C19H15F2N5O |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | (4,4-difluoropiperidin-1-yl)-[1-(6-isocyano-3-pyridinyl)pyrrolo[2,3-b]pyridin-5-yl]methanone |
| SMILES | [C-]#[N+]c1ccc(-n2ccc3cc(C(=O)N4CCC(F)(F)CC4)cnc32)cn1 |
| InChI | InChI=1S/C19H15F2N5O/c1-22-16-3-2-15(12-23-16)26-7-4-13-10-14(11-24-17(13)26)18(27)25-8-5-19(20,21)6-9-25/h2-4,7,10-12H,5-6,8-9H2 |
| InChIKey | VKIQWECWXZXFGQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|