C31H38ClN7O2Si — CID 164780507
2-[4-[11-chloro-5-methyl-12-(1-methylindazol-5-yl)-4-oxo-10-(2-trimethylsilylethoxymethyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-3-yl]cyclohexyl]acetonitrile (PubChem CID 164780507) has the molecular formula C31H38ClN7O2Si and a molecular weight of 604.23 g/mol. Its IUPAC name is 2-[4-[11-chloro-5-methyl-12-(1-methylindazol-5-yl)-4-oxo-10-(2-trimethylsilylethoxymethyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-3-yl]cyclohexyl]acetonitrile.
| Compound Name | 2-[4-[11-chloro-5-methyl-12-(1-methylindazol-5-yl)-4-oxo-10-(2-trimethylsilylethoxymethyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-3-yl]cyclohexyl]acetonitrile |
|---|---|
| PubChem CID | 164780507 |
| Molecular Formula | C31H38ClN7O2Si |
| Molecular Weight | 604.23 g/mol |
| Exact Mass | 603.25 |
| IUPAC Name | 2-[4-[11-chloro-5-methyl-12-(1-methylindazol-5-yl)-4-oxo-10-(2-trimethylsilylethoxymethyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-3-yl]cyclohexyl]acetonitrile |
| SMILES | Cn1ncc2cc(-c3c(Cl)n(COCC[Si](C)(C)C)c4ncc5c(c34)n(C3CCC(CC#N)CC3)c(=O)n5C)ccc21 |
| InChI | InChI=1S/C31H38ClN7O2Si/c1-36-25-18-34-30-27(28(25)39(31(36)40)23-9-6-20(7-10-23)12-13-33)26(21-8-11-24-22(16-21)17-35-37(24)2)29(32)38(30)19-41-14-15-42(3,4)5/h8,11,16-18,20,23H,6-7,9-10,12,14-15,19H2,1-5H3 |
| InChIKey | MRPSCWXQWRMPDT-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 95.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.23 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|