C43H25N7 — CID 164780627
2-[4-[6-[2-(1,3,5-triazin-2-yl)quinolin-7-yl]quinolin-2-yl]naphthalen-1-yl]-1,10-phenanthroline (PubChem CID 164780627) has the molecular formula C43H25N7 and a molecular weight of 639.72 g/mol. Its IUPAC name is 2-[4-[6-[2-(1,3,5-triazin-2-yl)quinolin-7-yl]quinolin-2-yl]naphthalen-1-yl]-1,10-phenanthroline.
| Compound Name | 2-[4-[6-[2-(1,3,5-triazin-2-yl)quinolin-7-yl]quinolin-2-yl]naphthalen-1-yl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 164780627 |
| Molecular Formula | C43H25N7 |
| Molecular Weight | 639.72 g/mol |
| Exact Mass | 639.22 |
| IUPAC Name | 2-[4-[6-[2-(1,3,5-triazin-2-yl)quinolin-7-yl]quinolin-2-yl]naphthalen-1-yl]-1,10-phenanthroline |
| SMILES | c1cnc2c(c1)ccc1ccc(-c3ccc(-c4ccc5cc(-c6ccc7ccc(-c8ncncn8)nc7c6)ccc5n4)c4ccccc34)nc12 |
| InChI | InChI=1S/C43H25N7/c1-2-6-33-32(5-1)34(15-16-35(33)38-18-12-28-9-8-27-4-3-21-45-41(27)42(28)50-38)37-19-14-31-22-29(13-17-36(31)48-37)30-10-7-26-11-20-39(49-40(26)23-30)43-46-24-44-25-47-43/h1-25H |
| InChIKey | JNQJFWHFRKSZCK-UHFFFAOYSA-N |
| XLogP | 9.89 |
| TPSA | 90.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.72 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|