C18H24O2S — CID 164781577
(1R,4aS,8aR)-8a-hydroxy-1,4a-dimethyl-7-phenylsulfanyl-3,4,5,6,7,8-hexahydro-1H-naphthalen-2-one (PubChem CID 164781577) has the molecular formula C18H24O2S and a molecular weight of 304.45 g/mol. Its IUPAC name is (1R,4aS,8aR)-8a-hydroxy-1,4a-dimethyl-7-phenylsulfanyl-3,4,5,6,7,8-hexahydro-1H-naphthalen-2-one.
| Compound Name | (1R,4aS,8aR)-8a-hydroxy-1,4a-dimethyl-7-phenylsulfanyl-3,4,5,6,7,8-hexahydro-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 164781577 |
| Molecular Formula | C18H24O2S |
| Molecular Weight | 304.45 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | (1R,4aS,8aR)-8a-hydroxy-1,4a-dimethyl-7-phenylsulfanyl-3,4,5,6,7,8-hexahydro-1H-naphthalen-2-one |
| SMILES | C[C@H]1C(=O)CC[C@@]2(C)CCC(Sc3ccccc3)C[C@@]12O |
| InChI | InChI=1S/C18H24O2S/c1-13-16(19)9-11-17(2)10-8-15(12-18(13,17)20)21-14-6-4-3-5-7-14/h3-7,13,15,20H,8-12H2,1-2H3/t13-,15?,17+,18+/m0/s1 |
| InChIKey | DSDWXKYQAGWEJZ-PNZZAUQMSA-N |
| XLogP | 4.07 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.45 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |