About 2-[[(1S)-2,2-dimethylcyclobutyl]methyl]-1,3-dioxolane
2-[[(1S)-2,2-dimethylcyclobutyl]methyl]-1,3-dioxolane (PubChem CID 164781615) has the molecular formula C10H18O2
and a molecular weight of 170.25 g/mol. Its IUPAC name is 2-[[(1S)-2,2-dimethylcyclobutyl]methyl]-1,3-dioxolane.
Molecular Properties
| Compound Name | 2-[[(1S)-2,2-dimethylcyclobutyl]methyl]-1,3-dioxolane |
| PubChem CID | 164781615 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | 2-[[(1S)-2,2-dimethylcyclobutyl]methyl]-1,3-dioxolane |
| SMILES | CC1(C)CC[C@H]1CC1OCCO1 |
| InChI | InChI=1S/C10H18O2/c1-10(2)4-3-8(10)7-9-11-5-6-12-9/h8-9H,3-7H2,1-2H3/t8-/m0/s1 |
| InChIKey | MVUYCMXNQYUPGS-QMMMGPOBSA-N |
| XLogP | 2.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[[(1S)-2,2-dimethylcyclobutyl]methyl]-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(1S)-2,2-dimethylcyclobutyl]methyl]-1,3-dioxolane?
The IUPAC name of 2-[[(1S)-2,2-dimethylcyclobutyl]methyl]-1,3-dioxolane (CID 164781615) is 2-[[(1S)-2,2-dimethylcyclobutyl]methyl]-1,3-dioxolane.
What is the SMILES notation for 2-[[(1S)-2,2-dimethylcyclobutyl]methyl]-1,3-dioxolane?
The canonical SMILES for 2-[[(1S)-2,2-dimethylcyclobutyl]methyl]-1,3-dioxolane is CC1(C)CC[C@H]1CC1OCCO1.
What is the InChIKey of 2-[[(1S)-2,2-dimethylcyclobutyl]methyl]-1,3-dioxolane?
The InChIKey is MVUYCMXNQYUPGS-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H18O2/c1-10(2)4-3-8(10)7-9-11-5-6-12-9/h8-9H,3-7H2,1-2H3/t8-/m0/s1.
What are the key properties of 2-[[(1S)-2,2-dimethylcyclobutyl]methyl]-1,3-dioxolane?
2-[[(1S)-2,2-dimethylcyclobutyl]methyl]-1,3-dioxolane has a molecular weight of 170.25 g/mol, XLogP of 2.19, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(1S)-2,2-dimethylcyclobutyl]methyl]-1,3-dioxolane is sourced from PubChem (CID 164781615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).