C24H23ClFN3O5 — CID 164782110
N-[(3S)-1-[(2S)-2-[4-(2-chloro-4-fluorophenyl)quinolin-7-yl]oxy-2-hydroxyacetyl]piperidin-3-yl]-N-hydroxyacetamide (PubChem CID 164782110) has the molecular formula C24H23ClFN3O5 and a molecular weight of 487.92 g/mol. Its IUPAC name is N-[(3S)-1-[(2S)-2-[4-(2-chloro-4-fluorophenyl)quinolin-7-yl]oxy-2-hydroxyacetyl]piperidin-3-yl]-N-hydroxyacetamide.
| Compound Name | N-[(3S)-1-[(2S)-2-[4-(2-chloro-4-fluorophenyl)quinolin-7-yl]oxy-2-hydroxyacetyl]piperidin-3-yl]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 164782110 |
| Molecular Formula | C24H23ClFN3O5 |
| Molecular Weight | 487.92 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | N-[(3S)-1-[(2S)-2-[4-(2-chloro-4-fluorophenyl)quinolin-7-yl]oxy-2-hydroxyacetyl]piperidin-3-yl]-N-hydroxyacetamide |
| SMILES | CC(=O)N(O)[C@H]1CCCN(C(=O)[C@@H](O)Oc2ccc3c(-c4ccc(F)cc4Cl)ccnc3c2)C1 |
| InChI | InChI=1S/C24H23ClFN3O5/c1-14(30)29(33)16-3-2-10-28(13-16)23(31)24(32)34-17-5-7-20-18(8-9-27-22(20)12-17)19-6-4-15(26)11-21(19)25/h4-9,11-12,16,24,32-33H,2-3,10,13H2,1H3/t16-,24-/m0/s1 |
| InChIKey | LKKJMONECRCBNR-FYSMJZIKSA-N |
| XLogP | 3.62 |
| TPSA | 103.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.92 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|