C53H35N5 — CID 164782219
10-[4-[4,6-bis(3-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-11-phenylindolo[1,2-a]benzimidazole (PubChem CID 164782219) has the molecular formula C53H35N5 and a molecular weight of 741.90 g/mol. Its IUPAC name is 10-[4-[4,6-bis(3-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-11-phenylindolo[1,2-a]benzimidazole.
| Compound Name | 10-[4-[4,6-bis(3-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-11-phenylindolo[1,2-a]benzimidazole |
|---|---|
| PubChem CID | 164782219 |
| Molecular Formula | C53H35N5 |
| Molecular Weight | 741.90 g/mol |
| Exact Mass | 741.29 |
| IUPAC Name | 10-[4-[4,6-bis(3-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-11-phenylindolo[1,2-a]benzimidazole |
| SMILES | c1ccc(-c2cccc(-c3nc(-c4ccc(-n5c6ccccc6n6c7ccccc7c(-c7ccccc7)c56)cc4)nc(-c4cccc(-c5ccccc5)c4)n3)c2)cc1 |
| InChI | InChI=1S/C53H35N5/c1-4-16-36(17-5-1)40-22-14-24-42(34-40)51-54-50(55-52(56-51)43-25-15-23-41(35-43)37-18-6-2-7-19-37)39-30-32-44(33-31-39)57-47-28-12-13-29-48(47)58-46-27-11-10-26-45(46)49(53(57)58)38-20-8-3-9-21-38/h1-35H |
| InChIKey | WIMHQQDQOKKIDL-UHFFFAOYSA-N |
| XLogP | 13.22 |
| TPSA | 48.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.90 |
| LogP ≤ 5 | 13.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |