C75H72B2N7OPt-3 — CID 164782803
CID 164782803 (PubChem CID 164782803) has the molecular formula C75H72B2N7OPt-3 and a molecular weight of 1307.17 g/mol.
| Compound Name | CID 164782803 |
|---|---|
| PubChem CID | 164782803 |
| Molecular Formula | C75H72B2N7OPt-3 |
| Molecular Weight | 1307.17 g/mol |
| Exact Mass | 1306.58 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])n1c(-n2c3[c-]c(Oc4[c-]c(N5[CH-]N(c6c(/C7=C/C=C\N/C=C\C=C/[B]7)cc(C(C)(C)C)cc6/C6=C/C=C\N/C=C\C=C/[B]6)c6ccccc65)cc(-c5c(C(C)C)cccc5C(C)C)c4)ccc3c3cc(C(C)(C)C)ccc32)nc2ccccc21.[Pt] |
| InChI | InChI=1S/C75H72B2N7O.Pt/c1-49(2)57-23-20-24-58(50(3)4)71(57)51-41-54(46-56(42-51)85-55-32-33-59-60-43-52(74(5,6)7)31-34-66(60)84(70(59)47-55)73-80-65-27-12-13-28-67(65)81(73)11)82-48-83(69-30-15-14-29-68(69)82)72-61(63-25-21-39-78-37-18-16-35-76-63)44-53(75(8,9)10)45-62(72)64-26-22-40-79-38-19-17-36-77-64;/h12-45,48-50,78-79H,1-11H3;/q-3;/b35-16-,36-17-,37-18-,38-19-,39-21-,40-22-,63-25-,64-26-;/i11D3; |
| InChIKey | OXCOSYSLIGYBQD-BLIBKDMQSA-N |
| XLogP | 18.36 |
| TPSA | 62.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 86 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1307.17 |
| LogP ≤ 5 | 18.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|