C32H31N7O2 — CID 164783001
5-benzyl-7-[1-[(4-methoxyphenyl)methyl]-3-(methylamino)indazol-6-yl]-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-8-one (PubChem CID 164783001) has the molecular formula C32H31N7O2 and a molecular weight of 545.65 g/mol. Its IUPAC name is 5-benzyl-7-[1-[(4-methoxyphenyl)methyl]-3-(methylamino)indazol-6-yl]-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-8-one.
| Compound Name | 5-benzyl-7-[1-[(4-methoxyphenyl)methyl]-3-(methylamino)indazol-6-yl]-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-8-one |
|---|---|
| PubChem CID | 164783001 |
| Molecular Formula | C32H31N7O2 |
| Molecular Weight | 545.65 g/mol |
| Exact Mass | 545.25 |
| IUPAC Name | 5-benzyl-7-[1-[(4-methoxyphenyl)methyl]-3-(methylamino)indazol-6-yl]-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-8-one |
| SMILES | CNc1nn(Cc2ccc(OC)cc2)c2cc(-n3c(=O)c4c(n5ncc(Cc6ccccc6)c35)CNCC4)ccc12 |
| InChI | InChI=1S/C32H31N7O2/c1-33-30-26-13-10-24(17-28(26)37(36-30)20-22-8-11-25(41-2)12-9-22)38-31-23(16-21-6-4-3-5-7-21)18-35-39(31)29-19-34-15-14-27(29)32(38)40/h3-13,17-18,34H,14-16,19-20H2,1-2H3,(H,33,36) |
| InChIKey | IZWZBACOGGUYCE-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.65 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |