C51H30N2S3 — CID 164783772
2-[3-(1,3-benzothiazol-2-yl)-5-(2,3,4,6-tetradeuterio-5-spiro[fluorene-9,9'-thioxanthene]-3-ylphenyl)phenyl]-1,3-benzothiazole (PubChem CID 164783772) has the molecular formula C51H30N2S3 and a molecular weight of 771.04 g/mol. Its IUPAC name is 2-[3-(1,3-benzothiazol-2-yl)-5-(2,3,4,6-tetradeuterio-5-spiro[fluorene-9,9'-thioxanthene]-3-ylphenyl)phenyl]-1,3-benzothiazole.
| Compound Name | 2-[3-(1,3-benzothiazol-2-yl)-5-(2,3,4,6-tetradeuterio-5-spiro[fluorene-9,9'-thioxanthene]-3-ylphenyl)phenyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 164783772 |
| Molecular Formula | C51H30N2S3 |
| Molecular Weight | 771.04 g/mol |
| Exact Mass | 770.18 |
| IUPAC Name | 2-[3-(1,3-benzothiazol-2-yl)-5-(2,3,4,6-tetradeuterio-5-spiro[fluorene-9,9'-thioxanthene]-3-ylphenyl)phenyl]-1,3-benzothiazole |
| SMILES | [2H]c1c([2H])c(-c2cc(-c3nc4ccccc4s3)cc(-c3nc4ccccc4s3)c2)c([2H])c(-c2ccc3c(c2)-c2ccccc2C32c3ccccc3Sc3ccccc32)c1[2H] |
| InChI | InChI=1S/C51H30N2S3/c1-2-15-39-37(14-1)38-30-33(24-25-40(38)51(39)41-16-3-7-20-45(41)54-46-21-8-4-17-42(46)51)31-12-11-13-32(26-31)34-27-35(49-52-43-18-5-9-22-47(43)55-49)29-36(28-34)50-53-44-19-6-10-23-48(44)56-50/h1-30H/i11D,12D,13D,26D |
| InChIKey | QFCHUKGALVWFTL-HVEGZYIMSA-N |
| XLogP | 14.40 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.04 |
| LogP ≤ 5 | 14.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |