C49H44BN — CID 164784151
bis(4-tert-butylphenyl)-[4-(6-phenylbenzo[k]phenanthridin-3-yl)phenyl]borane (PubChem CID 164784151) has the molecular formula C49H44BN and a molecular weight of 657.71 g/mol. Its IUPAC name is bis(4-tert-butylphenyl)-[4-(6-phenylbenzo[k]phenanthridin-3-yl)phenyl]borane.
| Compound Name | bis(4-tert-butylphenyl)-[4-(6-phenylbenzo[k]phenanthridin-3-yl)phenyl]borane |
|---|---|
| PubChem CID | 164784151 |
| Molecular Formula | C49H44BN |
| Molecular Weight | 657.71 g/mol |
| Exact Mass | 657.36 |
| IUPAC Name | bis(4-tert-butylphenyl)-[4-(6-phenylbenzo[k]phenanthridin-3-yl)phenyl]borane |
| SMILES | CC(C)(C)c1ccc(B(c2ccc(-c3ccc4c(c3)nc(-c3ccccc3)c3ccc5ccccc5c34)cc2)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C49H44BN/c1-48(2,3)37-20-26-40(27-21-37)50(41-28-22-38(23-29-41)49(4,5)6)39-24-16-33(17-25-39)36-19-30-43-45(32-36)51-47(35-13-8-7-9-14-35)44-31-18-34-12-10-11-15-42(34)46(43)44/h7-32H,1-6H3 |
| InChIKey | FPTBFFBYRHAUPK-UHFFFAOYSA-N |
| XLogP | 10.99 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.71 |
| LogP ≤ 5 | 10.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|