C16H25F3N2O4 — CID 164785131
methyl (1R,2S,5S)-3-[(2S)-1-hydroxy-3-methyl-2-[(2,2,2-trifluoroacetyl)amino]butyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylate (PubChem CID 164785131) has the molecular formula C16H25F3N2O4 and a molecular weight of 366.38 g/mol. Its IUPAC name is methyl (1R,2S,5S)-3-[(2S)-1-hydroxy-3-methyl-2-[(2,2,2-trifluoroacetyl)amino]butyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylate.
| Compound Name | methyl (1R,2S,5S)-3-[(2S)-1-hydroxy-3-methyl-2-[(2,2,2-trifluoroacetyl)amino]butyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylate |
|---|---|
| PubChem CID | 164785131 |
| Molecular Formula | C16H25F3N2O4 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | methyl (1R,2S,5S)-3-[(2S)-1-hydroxy-3-methyl-2-[(2,2,2-trifluoroacetyl)amino]butyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H]2[C@H](CN1C(O)[C@@H](NC(=O)C(F)(F)F)C(C)C)C2(C)C |
| InChI | InChI=1S/C16H25F3N2O4/c1-7(2)10(20-14(24)16(17,18)19)12(22)21-6-8-9(15(8,3)4)11(21)13(23)25-5/h7-12,22H,6H2,1-5H3,(H,20,24)/t8-,9-,10-,11-,12?/m0/s1 |
| InChIKey | KOJOOFBNWIJVCU-IUCLWQNPSA-N |
| XLogP | 1.14 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |