C15H23F3N2O4 — CID 164785138
(1R,2S,5S)-3-[(2S)-1-hydroxy-3-methyl-2-[(2,2,2-trifluoroacetyl)amino]butyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid (PubChem CID 164785138) has the molecular formula C15H23F3N2O4 and a molecular weight of 352.35 g/mol. Its IUPAC name is (1R,2S,5S)-3-[(2S)-1-hydroxy-3-methyl-2-[(2,2,2-trifluoroacetyl)amino]butyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid.
| Compound Name | (1R,2S,5S)-3-[(2S)-1-hydroxy-3-methyl-2-[(2,2,2-trifluoroacetyl)amino]butyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid |
|---|---|
| PubChem CID | 164785138 |
| Molecular Formula | C15H23F3N2O4 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | (1R,2S,5S)-3-[(2S)-1-hydroxy-3-methyl-2-[(2,2,2-trifluoroacetyl)amino]butyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid |
| SMILES | CC(C)[C@H](NC(=O)C(F)(F)F)C(O)N1C[C@H]2[C@@H]([C@H]1C(=O)O)C2(C)C |
| InChI | InChI=1S/C15H23F3N2O4/c1-6(2)9(19-13(24)15(16,17)18)11(21)20-5-7-8(14(7,3)4)10(20)12(22)23/h6-11,21H,5H2,1-4H3,(H,19,24)(H,22,23)/t7-,8-,9-,10-,11?/m0/s1 |
| InChIKey | YTOZPMQJQWESGE-LJHPZOEFSA-N |
| XLogP | 1.05 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |