C11H11F5N2 — CID 164785211
2,3,4,5,6-pentafluoro-N-(2-methylbutylideneamino)aniline (PubChem CID 164785211) has the molecular formula C11H11F5N2 and a molecular weight of 266.21 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-(2-methylbutylideneamino)aniline.
| Compound Name | 2,3,4,5,6-pentafluoro-N-(2-methylbutylideneamino)aniline |
|---|---|
| PubChem CID | 164785211 |
| Molecular Formula | C11H11F5N2 |
| Molecular Weight | 266.21 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-(2-methylbutylideneamino)aniline |
| SMILES | CCC(C)C=NNc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C11H11F5N2/c1-3-5(2)4-17-18-11-9(15)7(13)6(12)8(14)10(11)16/h4-5,18H,3H2,1-2H3 |
| InChIKey | LROPLOGXPIBEDI-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.21 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|