C68H44N6 — CID 164785763
5-[3,5-bis[3-(6-pyridin-4-yl-2-pyridinyl)phenyl]phenyl]-11,12-diphenylindolo[2,3-a]carbazole (PubChem CID 164785763) has the molecular formula C68H44N6 and a molecular weight of 945.14 g/mol. Its IUPAC name is 5-[3,5-bis[3-(6-pyridin-4-yl-2-pyridinyl)phenyl]phenyl]-11,12-diphenylindolo[2,3-a]carbazole.
| Compound Name | 5-[3,5-bis[3-(6-pyridin-4-yl-2-pyridinyl)phenyl]phenyl]-11,12-diphenylindolo[2,3-a]carbazole |
|---|---|
| PubChem CID | 164785763 |
| Molecular Formula | C68H44N6 |
| Molecular Weight | 945.14 g/mol |
| Exact Mass | 944.36 |
| IUPAC Name | 5-[3,5-bis[3-(6-pyridin-4-yl-2-pyridinyl)phenyl]phenyl]-11,12-diphenylindolo[2,3-a]carbazole |
| SMILES | c1ccc(-n2c3ccccc3c3cc(-c4cc(-c5cccc(-c6cccc(-c7ccncc7)n6)c5)cc(-c5cccc(-c6cccc(-c7ccncc7)n6)c5)c4)c4c5ccccc5n(-c5ccccc5)c4c32)cc1 |
| InChI | InChI=1S/C68H44N6/c1-3-19-54(20-4-1)73-64-29-9-7-23-56(64)59-44-58(66-57-24-8-10-30-65(57)74(68(66)67(59)73)55-21-5-2-6-22-55)53-42-51(47-15-11-17-49(39-47)62-27-13-25-60(71-62)45-31-35-69-36-32-45)41-52(43-53)48-16-12-18-50(40-48)63-28-14-26-61(72-63)46-33-37-70-38-34-46/h1-44H |
| InChIKey | MCFUXNMIHJUTAY-UHFFFAOYSA-N |
| XLogP | 17.13 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 945.14 |
| LogP ≤ 5 | 17.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |