C18H22N6O4 — CID 164786183
5-[5-(3-aminopropoxy)-2-methoxyanilino]-7-(methylamino)pyrazolo[1,5-a]pyrimidine-3-carboxylic acid (PubChem CID 164786183) has the molecular formula C18H22N6O4 and a molecular weight of 386.41 g/mol. Its IUPAC name is 5-[5-(3-aminopropoxy)-2-methoxyanilino]-7-(methylamino)pyrazolo[1,5-a]pyrimidine-3-carboxylic acid.
| Compound Name | 5-[5-(3-aminopropoxy)-2-methoxyanilino]-7-(methylamino)pyrazolo[1,5-a]pyrimidine-3-carboxylic acid |
|---|---|
| PubChem CID | 164786183 |
| Molecular Formula | C18H22N6O4 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 5-[5-(3-aminopropoxy)-2-methoxyanilino]-7-(methylamino)pyrazolo[1,5-a]pyrimidine-3-carboxylic acid |
| SMILES | CNc1cc(Nc2cc(OCCCN)ccc2OC)nc2c(C(=O)O)cnn12 |
| InChI | InChI=1S/C18H22N6O4/c1-20-16-9-15(23-17-12(18(25)26)10-21-24(16)17)22-13-8-11(28-7-3-6-19)4-5-14(13)27-2/h4-5,8-10,20H,3,6-7,19H2,1-2H3,(H,22,23)(H,25,26) |
| InChIKey | FCFYGKXOEGUBHO-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 136.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|