About [(Z)-[cyclopentyl-(9,9-diethyl-7-nitrofluoren-2-yl)methylidene]amino] butanoate
[(Z)-[cyclopentyl-(9,9-diethyl-7-nitrofluoren-2-yl)methylidene]amino] butanoate (PubChem CID 164786888) has the molecular formula C27H32N2O4
and a molecular weight of 448.56 g/mol. Its IUPAC name is [(Z)-[cyclopentyl-(9,9-diethyl-7-nitrofluoren-2-yl)methylidene]amino] butanoate.
Molecular Properties
| Compound Name | [(Z)-[cyclopentyl-(9,9-diethyl-7-nitrofluoren-2-yl)methylidene]amino] butanoate |
| PubChem CID | 164786888 |
| Molecular Formula | C27H32N2O4 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | [(Z)-[cyclopentyl-(9,9-diethyl-7-nitrofluoren-2-yl)methylidene]amino] butanoate |
| SMILES | CCCC(=O)O/N=C(\c1ccc2c(c1)C(CC)(CC)c1cc([N+](=O)[O-])ccc1-2)C1CCCC1 |
| InChI | InChI=1S/C27H32N2O4/c1-4-9-25(30)33-28-26(18-10-7-8-11-18)19-12-14-21-22-15-13-20(29(31)32)17-24(22)27(5-2,6-3)23(21)16-19/h12-18H,4-11H2,1-3H3/b28-26- |
| InChIKey | DPANUGLUSLYDMF-SGEDCAFJSA-N |
| XLogP | 6.92 |
| TPSA | 81.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-[cyclopentyl-(9,9-diethyl-7-nitrofluoren-2-yl)methylidene]amino] butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-[cyclopentyl-(9,9-diethyl-7-nitrofluoren-2-yl)methylidene]amino] butanoate?
The IUPAC name of [(Z)-[cyclopentyl-(9,9-diethyl-7-nitrofluoren-2-yl)methylidene]amino] butanoate (CID 164786888) is [(Z)-[cyclopentyl-(9,9-diethyl-7-nitrofluoren-2-yl)methylidene]amino] butanoate.
What is the SMILES notation for [(Z)-[cyclopentyl-(9,9-diethyl-7-nitrofluoren-2-yl)methylidene]amino] butanoate?
The canonical SMILES for [(Z)-[cyclopentyl-(9,9-diethyl-7-nitrofluoren-2-yl)methylidene]amino] butanoate is CCCC(=O)O/N=C(\c1ccc2c(c1)C(CC)(CC)c1cc([N+](=O)[O-])ccc1-2)C1CCCC1.
What is the InChIKey of [(Z)-[cyclopentyl-(9,9-diethyl-7-nitrofluoren-2-yl)methylidene]amino] butanoate?
The InChIKey is DPANUGLUSLYDMF-SGEDCAFJSA-N. The full InChI is InChI=1S/C27H32N2O4/c1-4-9-25(30)33-28-26(18-10-7-8-11-18)19-12-14-21-22-15-13-20(29(31)32)17-24(22)27(5-2,6-3)23(21)16-19/h12-18H,4-11H2,1-3H3/b28-26-.
What are the key properties of [(Z)-[cyclopentyl-(9,9-diethyl-7-nitrofluoren-2-yl)methylidene]amino] butanoate?
[(Z)-[cyclopentyl-(9,9-diethyl-7-nitrofluoren-2-yl)methylidene]amino] butanoate has a molecular weight of 448.56 g/mol, XLogP of 6.92, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-[cyclopentyl-(9,9-diethyl-7-nitrofluoren-2-yl)methylidene]amino] butanoate is sourced from PubChem (CID 164786888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).