C34H42F4IrNO2- — CID 164787297
(Z)-3,7-diethyl-1,1,1-trifluoro-6-hydroxynon-5-en-4-one;1-(3,5-dimethylbenzene-6-id-1-yl)-6-(2-fluoro-2-methylpropyl)isoquinoline;iridium (PubChem CID 164787297) has the molecular formula C34H42F4IrNO2- and a molecular weight of 764.92 g/mol. Its IUPAC name is (Z)-3,7-diethyl-1,1,1-trifluoro-6-hydroxynon-5-en-4-one;1-(3,5-dimethylbenzene-6-id-1-yl)-6-(2-fluoro-2-methylpropyl)isoquinoline;iridium.
| Compound Name | (Z)-3,7-diethyl-1,1,1-trifluoro-6-hydroxynon-5-en-4-one;1-(3,5-dimethylbenzene-6-id-1-yl)-6-(2-fluoro-2-methylpropyl)isoquinoline;iridium |
|---|---|
| PubChem CID | 164787297 |
| Molecular Formula | C34H42F4IrNO2- |
| Molecular Weight | 764.92 g/mol |
| Exact Mass | 765.28 |
| IUPAC Name | (Z)-3,7-diethyl-1,1,1-trifluoro-6-hydroxynon-5-en-4-one;1-(3,5-dimethylbenzene-6-id-1-yl)-6-(2-fluoro-2-methylpropyl)isoquinoline;iridium |
| SMILES | CCC(CC(F)(F)F)C(=O)/C=C(\O)C(CC)CC.Cc1[c-]c(-c2nccc3cc(CC(C)(C)F)ccc23)cc(C)c1.[Ir] |
| InChI | InChI=1S/C21H21FN.C13H21F3O2.Ir/c1-14-9-15(2)11-18(10-14)20-19-6-5-16(13-21(3,4)22)12-17(19)7-8-23-20;1-4-9(5-2)11(17)7-12(18)10(6-3)8-13(14,15)16;/h5-10,12H,13H2,1-4H3;7,9-10,17H,4-6,8H2,1-3H3;/q-1;;/b;11-7-; |
| InChIKey | AOVGSWRPBOQDHA-HUZFCYHXSA-N |
| XLogP | 10.02 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.92 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|