C44H82N4O10S2 — CID 164788307
[9-[[(2R)-1-[3-(dimethylamino)propoxy]-3-[[(2R)-3-[3-(dimethylamino)propoxy]-2-(3-octanoyloxypropanoylamino)-3-oxopropyl]disulfanyl]-1-oxopropan-2-yl]amino]-9-oxononyl] octanoate (PubChem CID 164788307) has the molecular formula C44H82N4O10S2 and a molecular weight of 891.29 g/mol. Its IUPAC name is [9-[[(2R)-1-[3-(dimethylamino)propoxy]-3-[[(2R)-3-[3-(dimethylamino)propoxy]-2-(3-octanoyloxypropanoylamino)-3-oxopropyl]disulfanyl]-1-oxopropan-2-yl]amino]-9-oxononyl] octanoate.
| Compound Name | [9-[[(2R)-1-[3-(dimethylamino)propoxy]-3-[[(2R)-3-[3-(dimethylamino)propoxy]-2-(3-octanoyloxypropanoylamino)-3-oxopropyl]disulfanyl]-1-oxopropan-2-yl]amino]-9-oxononyl] octanoate |
|---|---|
| PubChem CID | 164788307 |
| Molecular Formula | C44H82N4O10S2 |
| Molecular Weight | 891.29 g/mol |
| Exact Mass | 890.55 |
| IUPAC Name | [9-[[(2R)-1-[3-(dimethylamino)propoxy]-3-[[(2R)-3-[3-(dimethylamino)propoxy]-2-(3-octanoyloxypropanoylamino)-3-oxopropyl]disulfanyl]-1-oxopropan-2-yl]amino]-9-oxononyl] octanoate |
| SMILES | CCCCCCCC(=O)OCCCCCCCCC(=O)N[C@@H](CSSC[C@H](NC(=O)CCOC(=O)CCCCCCC)C(=O)OCCCN(C)C)C(=O)OCCCN(C)C |
| InChI | InChI=1S/C44H82N4O10S2/c1-7-9-11-15-20-26-41(51)55-31-22-18-14-13-17-19-25-39(49)45-37(43(53)57-32-23-29-47(3)4)35-59-60-36-38(44(54)58-33-24-30-48(5)6)46-40(50)28-34-56-42(52)27-21-16-12-10-8-2/h37-38H,7-36H2,1-6H3,(H,45,49)(H,46,50)/t37-,38-/m0/s1 |
| InChIKey | GJZKDZSJUREGEN-UWXQCODUSA-N |
| XLogP | 7.26 |
| TPSA | 169.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.29 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|