About 2-(2-butoxyethoxy)-6-[3-[hydroxy(dimethyl)silyl]-3-methylbutyl]oxane-3,4,5-triol
2-(2-butoxyethoxy)-6-[3-[hydroxy(dimethyl)silyl]-3-methylbutyl]oxane-3,4,5-triol (PubChem CID 164788376) has the molecular formula C18H38O7Si
and a molecular weight of 394.58 g/mol. Its IUPAC name is 2-(2-butoxyethoxy)-6-[3-[hydroxy(dimethyl)silyl]-3-methylbutyl]oxane-3,4,5-triol.
Molecular Properties
| Compound Name | 2-(2-butoxyethoxy)-6-[3-[hydroxy(dimethyl)silyl]-3-methylbutyl]oxane-3,4,5-triol |
| PubChem CID | 164788376 |
| Molecular Formula | C18H38O7Si |
| Molecular Weight | 394.58 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 2-(2-butoxyethoxy)-6-[3-[hydroxy(dimethyl)silyl]-3-methylbutyl]oxane-3,4,5-triol |
| SMILES | CCCCOCCOC1OC(CCC(C)(C)[Si](C)(C)O)C(O)C(O)C1O |
| InChI | InChI=1S/C18H38O7Si/c1-6-7-10-23-11-12-24-17-16(21)15(20)14(19)13(25-17)8-9-18(2,3)26(4,5)22/h13-17,19-22H,6-12H2,1-5H3 |
| InChIKey | ZMCBPFBMEZMIIQ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.58 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-butoxyethoxy)-6-[3-[hydroxy(dimethyl)silyl]-3-methylbutyl]oxane-3,4,5-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-butoxyethoxy)-6-[3-[hydroxy(dimethyl)silyl]-3-methylbutyl]oxane-3,4,5-triol?
The IUPAC name of 2-(2-butoxyethoxy)-6-[3-[hydroxy(dimethyl)silyl]-3-methylbutyl]oxane-3,4,5-triol (CID 164788376) is 2-(2-butoxyethoxy)-6-[3-[hydroxy(dimethyl)silyl]-3-methylbutyl]oxane-3,4,5-triol.
What is the SMILES notation for 2-(2-butoxyethoxy)-6-[3-[hydroxy(dimethyl)silyl]-3-methylbutyl]oxane-3,4,5-triol?
The canonical SMILES for 2-(2-butoxyethoxy)-6-[3-[hydroxy(dimethyl)silyl]-3-methylbutyl]oxane-3,4,5-triol is CCCCOCCOC1OC(CCC(C)(C)[Si](C)(C)O)C(O)C(O)C1O.
What is the InChIKey of 2-(2-butoxyethoxy)-6-[3-[hydroxy(dimethyl)silyl]-3-methylbutyl]oxane-3,4,5-triol?
The InChIKey is ZMCBPFBMEZMIIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H38O7Si/c1-6-7-10-23-11-12-24-17-16(21)15(20)14(19)13(25-17)8-9-18(2,3)26(4,5)22/h13-17,19-22H,6-12H2,1-5H3.
What are the key properties of 2-(2-butoxyethoxy)-6-[3-[hydroxy(dimethyl)silyl]-3-methylbutyl]oxane-3,4,5-triol?
2-(2-butoxyethoxy)-6-[3-[hydroxy(dimethyl)silyl]-3-methylbutyl]oxane-3,4,5-triol has a molecular weight of 394.58 g/mol, XLogP of 1.39, 11 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-butoxyethoxy)-6-[3-[hydroxy(dimethyl)silyl]-3-methylbutyl]oxane-3,4,5-triol is sourced from PubChem (CID 164788376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).