About 2-ethynyl-9,9-dimethyl-3,4-dihydrofluorene
2-ethynyl-9,9-dimethyl-3,4-dihydrofluorene (PubChem CID 164789632) has the molecular formula C17H16
and a molecular weight of 220.31 g/mol. Its IUPAC name is 2-ethynyl-9,9-dimethyl-3,4-dihydrofluorene.
Molecular Properties
| Compound Name | 2-ethynyl-9,9-dimethyl-3,4-dihydrofluorene |
| PubChem CID | 164789632 |
| Molecular Formula | C17H16 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 2-ethynyl-9,9-dimethyl-3,4-dihydrofluorene |
| SMILES | C#CC1=CC2=C(CC1)c1ccccc1C2(C)C |
| InChI | InChI=1S/C17H16/c1-4-12-9-10-14-13-7-5-6-8-15(13)17(2,3)16(14)11-12/h1,5-8,11H,9-10H2,2-3H3 |
| InChIKey | DMPPOQORDYRFMK-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-ethynyl-9,9-dimethyl-3,4-dihydrofluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethynyl-9,9-dimethyl-3,4-dihydrofluorene?
The IUPAC name of 2-ethynyl-9,9-dimethyl-3,4-dihydrofluorene (CID 164789632) is 2-ethynyl-9,9-dimethyl-3,4-dihydrofluorene.
What is the SMILES notation for 2-ethynyl-9,9-dimethyl-3,4-dihydrofluorene?
The canonical SMILES for 2-ethynyl-9,9-dimethyl-3,4-dihydrofluorene is C#CC1=CC2=C(CC1)c1ccccc1C2(C)C.
What is the InChIKey of 2-ethynyl-9,9-dimethyl-3,4-dihydrofluorene?
The InChIKey is DMPPOQORDYRFMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16/c1-4-12-9-10-14-13-7-5-6-8-15(13)17(2,3)16(14)11-12/h1,5-8,11H,9-10H2,2-3H3.
What are the key properties of 2-ethynyl-9,9-dimethyl-3,4-dihydrofluorene?
2-ethynyl-9,9-dimethyl-3,4-dihydrofluorene has a molecular weight of 220.31 g/mol, XLogP of 4.08, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethynyl-9,9-dimethyl-3,4-dihydrofluorene is sourced from PubChem (CID 164789632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).