C26H43NO8 — CID 164791031
(1S,2R,4R,7S,8R,9S,13S,14S)-4-ethenyl-7,9,16,21-tetrahydroxy-2,4,8,12,12,19-hexamethyl-3,15,22-trioxa-19-azatetracyclo[12.8.0.02,7.08,13]docosan-6-one (PubChem CID 164791031) has the molecular formula C26H43NO8 and a molecular weight of 497.63 g/mol. Its IUPAC name is (1S,2R,4R,7S,8R,9S,13S,14S)-4-ethenyl-7,9,16,21-tetrahydroxy-2,4,8,12,12,19-hexamethyl-3,15,22-trioxa-19-azatetracyclo[12.8.0.02,7.08,13]docosan-6-one.
| Compound Name | (1S,2R,4R,7S,8R,9S,13S,14S)-4-ethenyl-7,9,16,21-tetrahydroxy-2,4,8,12,12,19-hexamethyl-3,15,22-trioxa-19-azatetracyclo[12.8.0.02,7.08,13]docosan-6-one |
|---|---|
| PubChem CID | 164791031 |
| Molecular Formula | C26H43NO8 |
| Molecular Weight | 497.63 g/mol |
| Exact Mass | 497.30 |
| IUPAC Name | (1S,2R,4R,7S,8R,9S,13S,14S)-4-ethenyl-7,9,16,21-tetrahydroxy-2,4,8,12,12,19-hexamethyl-3,15,22-trioxa-19-azatetracyclo[12.8.0.02,7.08,13]docosan-6-one |
| SMILES | C=C[C@@]1(C)CC(=O)[C@]2(O)[C@@]3(C)[C@@H](O)CCC(C)(C)[C@@H]3[C@@H]3OC(O)CCN(C)CC(O)O[C@@H]3[C@@]2(C)O1 |
| InChI | InChI=1S/C26H43NO8/c1-8-23(4)13-16(29)26(32)24(5)15(28)9-11-22(2,3)20(24)19-21(25(26,6)35-23)34-18(31)14-27(7)12-10-17(30)33-19/h8,15,17-21,28,30-32H,1,9-14H2,2-7H3/t15-,17?,18?,19-,20-,21-,23-,24-,25+,26-/m0/s1 |
| InChIKey | LRKGQBCVOLWDOV-WQXBEGAXSA-N |
| XLogP | 0.97 |
| TPSA | 128.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.63 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|