C15H8F4O4 — CID 164791131
4-[(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)oxy]benzaldehyde (PubChem CID 164791131) has the molecular formula C15H8F4O4 and a molecular weight of 328.22 g/mol. Its IUPAC name is 4-[(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)oxy]benzaldehyde.
| Compound Name | 4-[(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)oxy]benzaldehyde |
|---|---|
| PubChem CID | 164791131 |
| Molecular Formula | C15H8F4O4 |
| Molecular Weight | 328.22 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 4-[(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)oxy]benzaldehyde |
| SMILES | O=Cc1ccc(Oc2ccc3c(c2)OC(F)(F)C(F)(F)O3)cc1 |
| InChI | InChI=1S/C15H8F4O4/c16-14(17)15(18,19)23-13-7-11(5-6-12(13)22-14)21-10-3-1-9(8-20)2-4-10/h1-8H |
| InChIKey | ZHCFLCNBCPAFIE-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.22 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|