About 7-tert-butyl-1,5-naphthyridin-2-amine
7-tert-butyl-1,5-naphthyridin-2-amine (PubChem CID 164792594) has the molecular formula C12H15N3
and a molecular weight of 201.27 g/mol. Its IUPAC name is 7-tert-butyl-1,5-naphthyridin-2-amine.
Molecular Properties
| Compound Name | 7-tert-butyl-1,5-naphthyridin-2-amine |
| PubChem CID | 164792594 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 7-tert-butyl-1,5-naphthyridin-2-amine |
| SMILES | CC(C)(C)c1cnc2ccc(N)nc2c1 |
| InChI | InChI=1S/C12H15N3/c1-12(2,3)8-6-10-9(14-7-8)4-5-11(13)15-10/h4-7H,1-3H3,(H2,13,15) |
| InChIKey | NFNLMZBOZYWAER-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-tert-butyl-1,5-naphthyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-tert-butyl-1,5-naphthyridin-2-amine?
The IUPAC name of 7-tert-butyl-1,5-naphthyridin-2-amine (CID 164792594) is 7-tert-butyl-1,5-naphthyridin-2-amine.
What is the SMILES notation for 7-tert-butyl-1,5-naphthyridin-2-amine?
The canonical SMILES for 7-tert-butyl-1,5-naphthyridin-2-amine is CC(C)(C)c1cnc2ccc(N)nc2c1.
What is the InChIKey of 7-tert-butyl-1,5-naphthyridin-2-amine?
The InChIKey is NFNLMZBOZYWAER-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3/c1-12(2,3)8-6-10-9(14-7-8)4-5-11(13)15-10/h4-7H,1-3H3,(H2,13,15).
What are the key properties of 7-tert-butyl-1,5-naphthyridin-2-amine?
7-tert-butyl-1,5-naphthyridin-2-amine has a molecular weight of 201.27 g/mol, XLogP of 2.51, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-tert-butyl-1,5-naphthyridin-2-amine is sourced from PubChem (CID 164792594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).