About CID 164792716
CID 164792716 (PubChem CID 164792716) has the molecular formula C52H76LuN11O15-
and a molecular weight of 1270.21 g/mol.
Molecular Properties
| Compound Name | CID 164792716 |
| PubChem CID | 164792716 |
| Molecular Formula | C52H76LuN11O15- |
| Molecular Weight | 1270.21 g/mol |
| Exact Mass | 1269.49 |
| IUPAC Name | — |
| SMILES | CCNC(=O)c1nnc(-c2cc(C(C)C)c(O)cc2O)n1-c1ccc(CN2CCN(C(=O)CCOCCOCCOCCOCCNC(=O)CN3CCN(CC(=O)O)CCN(CC(=O)O)CCN4CC(=O)O[C-]4C3)CC2)cc1.[Lu] |
| InChI | InChI=1S/C52H76N11O15.Lu/c1-4-53-52(73)51-56-55-50(41-29-40(37(2)3)42(64)30-43(41)65)63(51)39-7-5-38(6-8-39)31-57-15-18-61(19-16-57)45(67)9-21-74-23-25-76-27-28-77-26-24-75-22-10-54-44(66)32-60-14-13-58(34-47(68)69)11-12-59(35-48(70)71)17-20-62-36-49(72)78-46(62)33-60;/h5-8,29-30,37,64-65H,4,9-28,31-36H2,1-3H3,(H,53,73)(H,54,66)(H,68,69)(H,70,71);/q-1; |
| InChIKey | TUGILQIYOLNPRA-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 303.70 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 79 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 1270.21 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 21 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 164792716 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 164792716?
The IUPAC name of CID 164792716 (CID 164792716) is not available.
What is the SMILES notation for CID 164792716?
The canonical SMILES for CID 164792716 is CCNC(=O)c1nnc(-c2cc(C(C)C)c(O)cc2O)n1-c1ccc(CN2CCN(C(=O)CCOCCOCCOCCOCCNC(=O)CN3CCN(CC(=O)O)CCN(CC(=O)O)CCN4CC(=O)O[C-]4C3)CC2)cc1.[Lu].
What is the InChIKey of CID 164792716?
The InChIKey is TUGILQIYOLNPRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C52H76N11O15.Lu/c1-4-53-52(73)51-56-55-50(41-29-40(37(2)3)42(64)30-43(41)65)63(51)39-7-5-38(6-8-39)31-57-15-18-61(19-16-57)45(67)9-21-74-23-25-76-27-28-77-26-24-75-22-10-54-44(66)32-60-14-13-58(34-47(68)69)11-12-59(35-48(70)71)17-20-62-36-49(72)78-46(62)33-60;/h5-8,29-30,37,64-65H,4,9-28,31-36H2,1-3H3,(H,53,73)(H,54,66)(H,68,69)(H,70,71);/q-1;.
What are the key properties of CID 164792716?
CID 164792716 has a molecular weight of 1270.21 g/mol, XLogP of -0.13, 28 rotatable bonds, 6 hydrogen bond donors, and 21 hydrogen bond acceptors.
Where does this data come from?
All data for CID 164792716 is sourced from PubChem (CID 164792716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).