C57H37N3O — CID 164797807
2-(3,4-diphenylphenyl)-4-(9-phenyldibenzofuran-3-yl)-6-[4-(4-phenylphenyl)phenyl]-1,3,5-triazine (PubChem CID 164797807) has the molecular formula C57H37N3O and a molecular weight of 779.94 g/mol. Its IUPAC name is 2-(3,4-diphenylphenyl)-4-(9-phenyldibenzofuran-3-yl)-6-[4-(4-phenylphenyl)phenyl]-1,3,5-triazine.
| Compound Name | 2-(3,4-diphenylphenyl)-4-(9-phenyldibenzofuran-3-yl)-6-[4-(4-phenylphenyl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 164797807 |
| Molecular Formula | C57H37N3O |
| Molecular Weight | 779.94 g/mol |
| Exact Mass | 779.29 |
| IUPAC Name | 2-(3,4-diphenylphenyl)-4-(9-phenyldibenzofuran-3-yl)-6-[4-(4-phenylphenyl)phenyl]-1,3,5-triazine |
| SMILES | c1ccc(-c2ccc(-c3ccc(-c4nc(-c5ccc(-c6ccccc6)c(-c6ccccc6)c5)nc(-c5ccc6c(c5)oc5cccc(-c7ccccc7)c56)n4)cc3)cc2)cc1 |
| InChI | InChI=1S/C57H37N3O/c1-5-14-38(15-6-1)39-24-26-40(27-25-39)41-28-30-45(31-29-41)55-58-56(46-32-34-48(42-16-7-2-8-17-42)51(36-46)44-20-11-4-12-21-44)60-57(59-55)47-33-35-50-53(37-47)61-52-23-13-22-49(54(50)52)43-18-9-3-10-19-43/h1-37H |
| InChIKey | GCMYPZUPMQEAJP-UHFFFAOYSA-N |
| XLogP | 15.11 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.94 |
| LogP ≤ 5 | 15.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |