C22H26N6O3 — CID 164798280
2-[2-ethoxy-5-[(3-isocyanooxolan-3-yl)amino]phenyl]-5-methyl-7-propyl-3H-imidazo[5,1-f][1,2,4]triazin-4-one (PubChem CID 164798280) has the molecular formula C22H26N6O3 and a molecular weight of 422.49 g/mol. Its IUPAC name is 2-[2-ethoxy-5-[(3-isocyanooxolan-3-yl)amino]phenyl]-5-methyl-7-propyl-3H-imidazo[5,1-f][1,2,4]triazin-4-one.
| Compound Name | 2-[2-ethoxy-5-[(3-isocyanooxolan-3-yl)amino]phenyl]-5-methyl-7-propyl-3H-imidazo[5,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 164798280 |
| Molecular Formula | C22H26N6O3 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 2-[2-ethoxy-5-[(3-isocyanooxolan-3-yl)amino]phenyl]-5-methyl-7-propyl-3H-imidazo[5,1-f][1,2,4]triazin-4-one |
| SMILES | [C-]#[N+]C1(Nc2ccc(OCC)c(-c3nn4c(CCC)nc(C)c4c(=O)[nH]3)c2)CCOC1 |
| InChI | InChI=1S/C22H26N6O3/c1-5-7-18-24-14(3)19-21(29)25-20(27-28(18)19)16-12-15(8-9-17(16)31-6-2)26-22(23-4)10-11-30-13-22/h8-9,12,26H,5-7,10-11,13H2,1-3H3,(H,25,27,29) |
| InChIKey | RAYKAEIDQXQEHX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 97.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|