About 1-[6-(difluoromethoxy)pyridazin-3-yl]ethane-1,2-diol
1-[6-(difluoromethoxy)pyridazin-3-yl]ethane-1,2-diol (PubChem CID 164798695) has the molecular formula C7H8F2N2O3
and a molecular weight of 206.15 g/mol. Its IUPAC name is 1-[6-(difluoromethoxy)pyridazin-3-yl]ethane-1,2-diol.
Molecular Properties
| Compound Name | 1-[6-(difluoromethoxy)pyridazin-3-yl]ethane-1,2-diol |
| PubChem CID | 164798695 |
| Molecular Formula | C7H8F2N2O3 |
| Molecular Weight | 206.15 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | 1-[6-(difluoromethoxy)pyridazin-3-yl]ethane-1,2-diol |
| SMILES | OCC(O)c1ccc(OC(F)F)nn1 |
| InChI | InChI=1S/C7H8F2N2O3/c8-7(9)14-6-2-1-4(10-11-6)5(13)3-12/h1-2,5,7,12-13H,3H2 |
| InChIKey | POHLYDGVMUKIHH-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 75.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.15 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[6-(difluoromethoxy)pyridazin-3-yl]ethane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-(difluoromethoxy)pyridazin-3-yl]ethane-1,2-diol?
The IUPAC name of 1-[6-(difluoromethoxy)pyridazin-3-yl]ethane-1,2-diol (CID 164798695) is 1-[6-(difluoromethoxy)pyridazin-3-yl]ethane-1,2-diol.
What is the SMILES notation for 1-[6-(difluoromethoxy)pyridazin-3-yl]ethane-1,2-diol?
The canonical SMILES for 1-[6-(difluoromethoxy)pyridazin-3-yl]ethane-1,2-diol is OCC(O)c1ccc(OC(F)F)nn1.
What is the InChIKey of 1-[6-(difluoromethoxy)pyridazin-3-yl]ethane-1,2-diol?
The InChIKey is POHLYDGVMUKIHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8F2N2O3/c8-7(9)14-6-2-1-4(10-11-6)5(13)3-12/h1-2,5,7,12-13H,3H2.
What are the key properties of 1-[6-(difluoromethoxy)pyridazin-3-yl]ethane-1,2-diol?
1-[6-(difluoromethoxy)pyridazin-3-yl]ethane-1,2-diol has a molecular weight of 206.15 g/mol, XLogP of 0.10, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-(difluoromethoxy)pyridazin-3-yl]ethane-1,2-diol is sourced from PubChem (CID 164798695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).