C21H22F2N6O4 — CID 164798832
(4-amino-1,3-dihydrofuro[3,4-c][1,7]naphthyridin-8-yl)-[(3S,5R)-3-[6-(difluoromethoxy)-1,2-dihydropyridazin-3-yl]-5-methylmorpholin-4-yl]methanone (PubChem CID 164798832) has the molecular formula C21H22F2N6O4 and a molecular weight of 460.44 g/mol. Its IUPAC name is (4-amino-1,3-dihydrofuro[3,4-c][1,7]naphthyridin-8-yl)-[(3S,5R)-3-[6-(difluoromethoxy)-1,2-dihydropyridazin-3-yl]-5-methylmorpholin-4-yl]methanone.
| Compound Name | (4-amino-1,3-dihydrofuro[3,4-c][1,7]naphthyridin-8-yl)-[(3S,5R)-3-[6-(difluoromethoxy)-1,2-dihydropyridazin-3-yl]-5-methylmorpholin-4-yl]methanone |
|---|---|
| PubChem CID | 164798832 |
| Molecular Formula | C21H22F2N6O4 |
| Molecular Weight | 460.44 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | (4-amino-1,3-dihydrofuro[3,4-c][1,7]naphthyridin-8-yl)-[(3S,5R)-3-[6-(difluoromethoxy)-1,2-dihydropyridazin-3-yl]-5-methylmorpholin-4-yl]methanone |
| SMILES | C[C@@H]1COC[C@H](C2=CC=C(OC(F)F)NN2)N1C(=O)c1cc2c3c(c(N)nc2cn1)COC3 |
| InChI | InChI=1S/C21H22F2N6O4/c1-10-6-31-9-17(14-2-3-18(28-27-14)33-21(22)23)29(10)20(30)15-4-11-12-7-32-8-13(12)19(24)26-16(11)5-25-15/h2-5,10,17,21,27-28H,6-9H2,1H3,(H2,24,26)/t10-,17-/m1/s1 |
| InChIKey | UPKLTWZNYKNCNR-BMLIUANNSA-N |
| XLogP | 1.54 |
| TPSA | 123.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.44 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |