(10-phenylnaphtho[2,1-b][1]benzothiol-8-yl)boronic acid

C22H15BO2S — CID 164799797

IUPAC(10-phenylnaphtho[2,1-b][1]benzothiol-8-yl)boronic acid
SMILESOB(O)c1cc(-c2ccccc2)cc2c1sc1ccc3ccccc3c12
InChIInChI=1S/C22H15BO2S/c24-23(25)19-13-16(14-6-2-1-3-7-14)12-18-21-17-9-5-4-8-15(17)10-11-20(21)26-22(18)19/h1-13,24-25H
InChIKeyDVWFQXMMJTTYQC-UHFFFAOYSA-N
MW354.24 g/mol
LogP4.55
Rot. Bonds2

About (10-phenylnaphtho[2,1-b][1]benzothiol-8-yl)boronic acid

(10-phenylnaphtho[2,1-b][1]benzothiol-8-yl)boronic acid (PubChem CID 164799797) has the molecular formula C22H15BO2S and a molecular weight of 354.24 g/mol. Its IUPAC name is (10-phenylnaphtho[2,1-b][1]benzothiol-8-yl)boronic acid.

Molecular Properties

Compound Name(10-phenylnaphtho[2,1-b][1]benzothiol-8-yl)boronic acid
PubChem CID164799797
Molecular FormulaC22H15BO2S
Molecular Weight354.24 g/mol
Exact Mass354.09
IUPAC Name(10-phenylnaphtho[2,1-b][1]benzothiol-8-yl)boronic acid
SMILESOB(O)c1cc(-c2ccccc2)cc2c1sc1ccc3ccccc3c12
InChIInChI=1S/C22H15BO2S/c24-23(25)19-13-16(14-6-2-1-3-7-14)12-18-21-17-9-5-4-8-15(17)10-11-20(21)26-22(18)19/h1-13,24-25H
InChIKeyDVWFQXMMJTTYQC-UHFFFAOYSA-N
XLogP4.55
TPSA40.46 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms26
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500354.24
LogP ≤ 54.55
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (10-phenylnaphtho[2,1-b][1]benzothiol-8-yl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (10-phenylnaphtho[2,1-b][1]benzothiol-8-yl)boronic acid?
The IUPAC name of (10-phenylnaphtho[2,1-b][1]benzothiol-8-yl)boronic acid (CID 164799797) is (10-phenylnaphtho[2,1-b][1]benzothiol-8-yl)boronic acid.
What is the SMILES notation for (10-phenylnaphtho[2,1-b][1]benzothiol-8-yl)boronic acid?
The canonical SMILES for (10-phenylnaphtho[2,1-b][1]benzothiol-8-yl)boronic acid is OB(O)c1cc(-c2ccccc2)cc2c1sc1ccc3ccccc3c12.
What is the InChIKey of (10-phenylnaphtho[2,1-b][1]benzothiol-8-yl)boronic acid?
The InChIKey is DVWFQXMMJTTYQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15BO2S/c24-23(25)19-13-16(14-6-2-1-3-7-14)12-18-21-17-9-5-4-8-15(17)10-11-20(21)26-22(18)19/h1-13,24-25H.
What are the key properties of (10-phenylnaphtho[2,1-b][1]benzothiol-8-yl)boronic acid?
(10-phenylnaphtho[2,1-b][1]benzothiol-8-yl)boronic acid has a molecular weight of 354.24 g/mol, XLogP of 4.55, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (10-phenylnaphtho[2,1-b][1]benzothiol-8-yl)boronic acid is sourced from PubChem (CID 164799797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).