C19H31NO2 — CID 164800119
2,4-bis(2,2-dimethylpropyl)-7-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 164800119) has the molecular formula C19H31NO2 and a molecular weight of 305.46 g/mol. Its IUPAC name is 2,4-bis(2,2-dimethylpropyl)-7-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 2,4-bis(2,2-dimethylpropyl)-7-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 164800119 |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | 2,4-bis(2,2-dimethylpropyl)-7-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CC1C=CC(CC(C)(C)C)C2C(=O)N(CC(C)(C)C)C(=O)C12 |
| InChI | InChI=1S/C19H31NO2/c1-12-8-9-13(10-18(2,3)4)15-14(12)16(21)20(17(15)22)11-19(5,6)7/h8-9,12-15H,10-11H2,1-7H3 |
| InChIKey | FKCSYRBSSFNVFB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|