C25H32O3S — CID 164800249
[2-tert-butyl-4-(5-tert-butyl-4-hydroxy-2-methylphenyl)sulfanyl-5-methylphenyl] prop-2-enoate (PubChem CID 164800249) has the molecular formula C25H32O3S and a molecular weight of 412.60 g/mol. Its IUPAC name is [2-tert-butyl-4-(5-tert-butyl-4-hydroxy-2-methylphenyl)sulfanyl-5-methylphenyl] prop-2-enoate.
| Compound Name | [2-tert-butyl-4-(5-tert-butyl-4-hydroxy-2-methylphenyl)sulfanyl-5-methylphenyl] prop-2-enoate |
|---|---|
| PubChem CID | 164800249 |
| Molecular Formula | C25H32O3S |
| Molecular Weight | 412.60 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | [2-tert-butyl-4-(5-tert-butyl-4-hydroxy-2-methylphenyl)sulfanyl-5-methylphenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1cc(C)c(Sc2cc(C(C)(C)C)c(O)cc2C)cc1C(C)(C)C |
| InChI | InChI=1S/C25H32O3S/c1-10-23(27)28-20-12-16(3)22(14-18(20)25(7,8)9)29-21-13-17(24(4,5)6)19(26)11-15(21)2/h10-14,26H,1H2,2-9H3 |
| InChIKey | ISBBNFNFYQMMQK-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.60 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|