C28H16F8O6S2 — CID 164800259
1-(4-fluorophenyl)sulfonyl-4-[1,2,2,3,3,4-hexafluoro-4-[4-(4-fluorophenyl)sulfonylphenoxy]cyclobutyl]oxybenzene (PubChem CID 164800259) has the molecular formula C28H16F8O6S2 and a molecular weight of 664.55 g/mol. Its IUPAC name is 1-(4-fluorophenyl)sulfonyl-4-[1,2,2,3,3,4-hexafluoro-4-[4-(4-fluorophenyl)sulfonylphenoxy]cyclobutyl]oxybenzene.
| Compound Name | 1-(4-fluorophenyl)sulfonyl-4-[1,2,2,3,3,4-hexafluoro-4-[4-(4-fluorophenyl)sulfonylphenoxy]cyclobutyl]oxybenzene |
|---|---|
| PubChem CID | 164800259 |
| Molecular Formula | C28H16F8O6S2 |
| Molecular Weight | 664.55 g/mol |
| Exact Mass | 664.03 |
| IUPAC Name | 1-(4-fluorophenyl)sulfonyl-4-[1,2,2,3,3,4-hexafluoro-4-[4-(4-fluorophenyl)sulfonylphenoxy]cyclobutyl]oxybenzene |
| SMILES | O=S(=O)(c1ccc(F)cc1)c1ccc(OC2(F)C(F)(F)C(F)(F)C2(F)Oc2ccc(S(=O)(=O)c3ccc(F)cc3)cc2)cc1 |
| InChI | InChI=1S/C28H16F8O6S2/c29-17-1-9-21(10-2-17)43(37,38)23-13-5-19(6-14-23)41-27(35)25(31,32)26(33,34)28(27,36)42-20-7-15-24(16-8-20)44(39,40)22-11-3-18(30)4-12-22/h1-16H |
| InChIKey | QHMHGDBSDIPPCC-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.55 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|