C9H13NO2 — CID 164802583
3,4,6,7,9,9a-hexahydro-1H-quinolizine-2,8-dione (PubChem CID 164802583) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is 3,4,6,7,9,9a-hexahydro-1H-quinolizine-2,8-dione.
| Compound Name | 3,4,6,7,9,9a-hexahydro-1H-quinolizine-2,8-dione |
|---|---|
| PubChem CID | 164802583 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 3,4,6,7,9,9a-hexahydro-1H-quinolizine-2,8-dione |
| SMILES | O=C1CCN2CCC(=O)CC2C1 |
| InChI | InChI=1S/C9H13NO2/c11-8-1-3-10-4-2-9(12)6-7(10)5-8/h7H,1-6H2 |
| InChIKey | QEDJKWAJINDUGS-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |