C46H34IrN2O2-2 — CID 164802848
4-(12-cyclopentyl-9,14-dioxapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1,3,5,7,10,12,15,17,19-nonaen-11-yl)-2-phenylpyridine;iridium;5-methyl-2-phenylpyridine (PubChem CID 164802848) has the molecular formula C46H34IrN2O2-2 and a molecular weight of 839.01 g/mol. Its IUPAC name is 4-(12-cyclopentyl-9,14-dioxapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1,3,5,7,10,12,15,17,19-nonaen-11-yl)-2-phenylpyridine;iridium;5-methyl-2-phenylpyridine.
| Compound Name | 4-(12-cyclopentyl-9,14-dioxapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1,3,5,7,10,12,15,17,19-nonaen-11-yl)-2-phenylpyridine;iridium;5-methyl-2-phenylpyridine |
|---|---|
| PubChem CID | 164802848 |
| Molecular Formula | C46H34IrN2O2-2 |
| Molecular Weight | 839.01 g/mol |
| Exact Mass | 839.23 |
| IUPAC Name | 4-(12-cyclopentyl-9,14-dioxapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1,3,5,7,10,12,15,17,19-nonaen-11-yl)-2-phenylpyridine;iridium;5-methyl-2-phenylpyridine |
| SMILES | Cc1ccc(-c2[c-]cccc2)nc1.[Ir].[c-]1ccccc1-c1cc(-c2c(C3CCCC3)c3oc4ccccc4c3c3c2oc2ccccc23)ccn1 |
| InChI | InChI=1S/C34H24NO2.C12H10N.Ir/c1-2-10-21(11-3-1)26-20-23(18-19-35-26)30-29(22-12-4-5-13-22)33-31(24-14-6-8-16-27(24)36-33)32-25-15-7-9-17-28(25)37-34(30)32;1-10-7-8-12(13-9-10)11-5-3-2-4-6-11;/h1-3,6-10,14-20,22H,4-5,12-13H2;2-5,7-9H,1H3;/q2*-1; |
| InChIKey | JBPLAIVLPBCSGB-UHFFFAOYSA-N |
| XLogP | 12.53 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.01 |
| LogP ≤ 5 | 12.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|