C12H10ClN — CID 164803143
2-chloro-4-methyl-5-(2,3,4,5,6-pentadeuteriophenyl)pyridine (PubChem CID 164803143) has the molecular formula C12H10ClN and a molecular weight of 208.70 g/mol. Its IUPAC name is 2-chloro-4-methyl-5-(2,3,4,5,6-pentadeuteriophenyl)pyridine.
| Compound Name | 2-chloro-4-methyl-5-(2,3,4,5,6-pentadeuteriophenyl)pyridine |
|---|---|
| PubChem CID | 164803143 |
| Molecular Formula | C12H10ClN |
| Molecular Weight | 208.70 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 2-chloro-4-methyl-5-(2,3,4,5,6-pentadeuteriophenyl)pyridine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cnc(Cl)cc2C)c([2H])c1[2H] |
| InChI | InChI=1S/C12H10ClN/c1-9-7-12(13)14-8-11(9)10-5-3-2-4-6-10/h2-8H,1H3/i2D,3D,4D,5D,6D |
| InChIKey | HGGBRNDIABCGNR-VIQYUKPQSA-N |
| XLogP | 3.71 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.70 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|