C24H26AuFN3P2S+ — CID 164804606
(4-fluorobenzene-6-id-1-yl)-diphenyl-sulfanylidene-λ5-phosphane;gold(1+);1,3,5-triaza-7-phosphoniatricyclo[3.3.1.13,7]decane (PubChem CID 164804606) has the molecular formula C24H26AuFN3P2S+ and a molecular weight of 666.47 g/mol. Its IUPAC name is (4-fluorobenzene-6-id-1-yl)-diphenyl-sulfanylidene-λ5-phosphane;gold(1+);1,3,5-triaza-7-phosphoniatricyclo[3.3.1.13,7]decane.
| Compound Name | (4-fluorobenzene-6-id-1-yl)-diphenyl-sulfanylidene-λ5-phosphane;gold(1+);1,3,5-triaza-7-phosphoniatricyclo[3.3.1.13,7]decane |
|---|---|
| PubChem CID | 164804606 |
| Molecular Formula | C24H26AuFN3P2S+ |
| Molecular Weight | 666.47 g/mol |
| Exact Mass | 666.10 |
| IUPAC Name | (4-fluorobenzene-6-id-1-yl)-diphenyl-sulfanylidene-λ5-phosphane;gold(1+);1,3,5-triaza-7-phosphoniatricyclo[3.3.1.13,7]decane |
| SMILES | C1N2CN3CN1C[PH+](C2)C3.Fc1c[c-]c(P(=S)(c2ccccc2)c2ccccc2)cc1.[Au+] |
| InChI | InChI=1S/C18H13FPS.C6H12N3P.Au/c19-15-11-13-18(14-12-15)20(21,16-7-3-1-4-8-16)17-9-5-2-6-10-17;1-7-2-9-3-8(1)5-10(4-7)6-9;/h1-13H;1-6H2;/q-1;;+1/p+1 |
| InChIKey | SZLWNZWMKPLJCP-UHFFFAOYSA-O |
| XLogP | 3.27 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|