C29H31N5O4S — CID 164804651
N-[6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-pyridinyl]-3-(1H-indol-3-yl)-2-[(4-methylphenyl)sulfonylamino]prop-2-enamide (PubChem CID 164804651) has the molecular formula C29H31N5O4S and a molecular weight of 545.67 g/mol. Its IUPAC name is N-[6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-pyridinyl]-3-(1H-indol-3-yl)-2-[(4-methylphenyl)sulfonylamino]prop-2-enamide.
| Compound Name | N-[6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-pyridinyl]-3-(1H-indol-3-yl)-2-[(4-methylphenyl)sulfonylamino]prop-2-enamide |
|---|---|
| PubChem CID | 164804651 |
| Molecular Formula | C29H31N5O4S |
| Molecular Weight | 545.67 g/mol |
| Exact Mass | 545.21 |
| IUPAC Name | N-[6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-3-pyridinyl]-3-(1H-indol-3-yl)-2-[(4-methylphenyl)sulfonylamino]prop-2-enamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(=Cc2c[nH]c3ccccc23)C(=O)Nc2ccc(N3C[C@@H](C)O[C@@H](C)C3)nc2)cc1 |
| InChI | InChI=1S/C29H31N5O4S/c1-19-8-11-24(12-9-19)39(36,37)33-27(14-22-15-30-26-7-5-4-6-25(22)26)29(35)32-23-10-13-28(31-16-23)34-17-20(2)38-21(3)18-34/h4-16,20-21,30,33H,17-18H2,1-3H3,(H,32,35)/t20-,21+ |
| InChIKey | RVJSYBKJORTXDF-OYRHEFFESA-N |
| XLogP | 4.44 |
| TPSA | 116.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.67 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|