C26H33N3O14S2 — CID 164804809
[2-hydroxy-3-[3-[2-hydroxy-3-[3-[(3-methoxy-3-oxopropyl)disulfanyl]propanoyloxy]propyl]-2,4,6-trioxo-5-prop-2-enyl-1,3,5-triazinan-1-yl]propyl] 3,4,5-trihydroxybenzoate (PubChem CID 164804809) has the molecular formula C26H33N3O14S2 and a molecular weight of 675.69 g/mol. Its IUPAC name is [2-hydroxy-3-[3-[2-hydroxy-3-[3-[(3-methoxy-3-oxopropyl)disulfanyl]propanoyloxy]propyl]-2,4,6-trioxo-5-prop-2-enyl-1,3,5-triazinan-1-yl]propyl] 3,4,5-trihydroxybenzoate.
| Compound Name | [2-hydroxy-3-[3-[2-hydroxy-3-[3-[(3-methoxy-3-oxopropyl)disulfanyl]propanoyloxy]propyl]-2,4,6-trioxo-5-prop-2-enyl-1,3,5-triazinan-1-yl]propyl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 164804809 |
| Molecular Formula | C26H33N3O14S2 |
| Molecular Weight | 675.69 g/mol |
| Exact Mass | 675.14 |
| IUPAC Name | [2-hydroxy-3-[3-[2-hydroxy-3-[3-[(3-methoxy-3-oxopropyl)disulfanyl]propanoyloxy]propyl]-2,4,6-trioxo-5-prop-2-enyl-1,3,5-triazinan-1-yl]propyl] 3,4,5-trihydroxybenzoate |
| SMILES | C=CCn1c(=O)n(CC(O)COC(=O)CCSSCCC(=O)OC)c(=O)n(CC(O)COC(=O)c2cc(O)c(O)c(O)c2)c1=O |
| InChI | InChI=1S/C26H33N3O14S2/c1-3-6-27-24(38)28(11-16(30)13-42-21(35)5-8-45-44-7-4-20(34)41-2)26(40)29(25(27)39)12-17(31)14-43-23(37)15-9-18(32)22(36)19(33)10-15/h3,9-10,16-17,30-33,36H,1,4-8,11-14H2,2H3 |
| InChIKey | SOGFRLPWHDBWCV-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 246.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.69 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|