C24H23ClN4O — CID 164806003
N-[3-(4-tert-butylphenyl)-1-methylpyrazol-5-yl]-6-chloroquinoline-7-carboxamide (PubChem CID 164806003) has the molecular formula C24H23ClN4O and a molecular weight of 418.93 g/mol. Its IUPAC name is N-[3-(4-tert-butylphenyl)-1-methylpyrazol-5-yl]-6-chloroquinoline-7-carboxamide.
| Compound Name | N-[3-(4-tert-butylphenyl)-1-methylpyrazol-5-yl]-6-chloroquinoline-7-carboxamide |
|---|---|
| PubChem CID | 164806003 |
| Molecular Formula | C24H23ClN4O |
| Molecular Weight | 418.93 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | N-[3-(4-tert-butylphenyl)-1-methylpyrazol-5-yl]-6-chloroquinoline-7-carboxamide |
| SMILES | Cn1nc(-c2ccc(C(C)(C)C)cc2)cc1NC(=O)c1cc2ncccc2cc1Cl |
| InChI | InChI=1S/C24H23ClN4O/c1-24(2,3)17-9-7-15(8-10-17)21-14-22(29(4)28-21)27-23(30)18-13-20-16(12-19(18)25)6-5-11-26-20/h5-14H,1-4H3,(H,27,30) |
| InChIKey | PXGASZFHRKITLB-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.93 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |