About 4-ethoxy-N-(2-methoxy-4-methylsulfonylphenyl)-1H-pyrazolo[5,4-d]pyrimidin-6-amine
4-ethoxy-N-(2-methoxy-4-methylsulfonylphenyl)-1H-pyrazolo[5,4-d]pyrimidin-6-amine (PubChem CID 164806062) has the molecular formula C15H17N5O4S
and a molecular weight of 363.40 g/mol. Its IUPAC name is 4-ethoxy-N-(2-methoxy-4-methylsulfonylphenyl)-1H-pyrazolo[5,4-d]pyrimidin-6-amine.
Molecular Properties
| Compound Name | 4-ethoxy-N-(2-methoxy-4-methylsulfonylphenyl)-1H-pyrazolo[5,4-d]pyrimidin-6-amine |
| PubChem CID | 164806062 |
| Molecular Formula | C15H17N5O4S |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 4-ethoxy-N-(2-methoxy-4-methylsulfonylphenyl)-1H-pyrazolo[5,4-d]pyrimidin-6-amine |
| SMILES | CCOc1nc(Nc2ccc(S(C)(=O)=O)cc2OC)nc2[nH]ncc12 |
| InChI | InChI=1S/C15H17N5O4S/c1-4-24-14-10-8-16-20-13(10)18-15(19-14)17-11-6-5-9(25(3,21)22)7-12(11)23-2/h5-8H,4H2,1-3H3,(H2,16,17,18,19,20) |
| InChIKey | POESODYRQOOMQM-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 119.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 4-ethoxy-N-(2-methoxy-4-methylsulfonylphenyl)-1H-pyrazolo[5,4-d]pyrimidin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxy-N-(2-methoxy-4-methylsulfonylphenyl)-1H-pyrazolo[5,4-d]pyrimidin-6-amine?
The IUPAC name of 4-ethoxy-N-(2-methoxy-4-methylsulfonylphenyl)-1H-pyrazolo[5,4-d]pyrimidin-6-amine (CID 164806062) is 4-ethoxy-N-(2-methoxy-4-methylsulfonylphenyl)-1H-pyrazolo[5,4-d]pyrimidin-6-amine.
What is the SMILES notation for 4-ethoxy-N-(2-methoxy-4-methylsulfonylphenyl)-1H-pyrazolo[5,4-d]pyrimidin-6-amine?
The canonical SMILES for 4-ethoxy-N-(2-methoxy-4-methylsulfonylphenyl)-1H-pyrazolo[5,4-d]pyrimidin-6-amine is CCOc1nc(Nc2ccc(S(C)(=O)=O)cc2OC)nc2[nH]ncc12.
What is the InChIKey of 4-ethoxy-N-(2-methoxy-4-methylsulfonylphenyl)-1H-pyrazolo[5,4-d]pyrimidin-6-amine?
The InChIKey is POESODYRQOOMQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N5O4S/c1-4-24-14-10-8-16-20-13(10)18-15(19-14)17-11-6-5-9(25(3,21)22)7-12(11)23-2/h5-8H,4H2,1-3H3,(H2,16,17,18,19,20).
What are the key properties of 4-ethoxy-N-(2-methoxy-4-methylsulfonylphenyl)-1H-pyrazolo[5,4-d]pyrimidin-6-amine?
4-ethoxy-N-(2-methoxy-4-methylsulfonylphenyl)-1H-pyrazolo[5,4-d]pyrimidin-6-amine has a molecular weight of 363.40 g/mol, XLogP of 1.91, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxy-N-(2-methoxy-4-methylsulfonylphenyl)-1H-pyrazolo[5,4-d]pyrimidin-6-amine is sourced from PubChem (CID 164806062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).