About 1-[(5E)-5-(2,2,2-trifluoroethylidene)cyclopenten-1-yl]pyrrolidine
1-[(5E)-5-(2,2,2-trifluoroethylidene)cyclopenten-1-yl]pyrrolidine (PubChem CID 164806139) has the molecular formula C11H14F3N
and a molecular weight of 217.23 g/mol. Its IUPAC name is 1-[(5E)-5-(2,2,2-trifluoroethylidene)cyclopenten-1-yl]pyrrolidine.
Molecular Properties
| Compound Name | 1-[(5E)-5-(2,2,2-trifluoroethylidene)cyclopenten-1-yl]pyrrolidine |
| PubChem CID | 164806139 |
| Molecular Formula | C11H14F3N |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 1-[(5E)-5-(2,2,2-trifluoroethylidene)cyclopenten-1-yl]pyrrolidine |
| SMILES | FC(F)(F)/C=C1\CCC=C1N1CCCC1 |
| InChI | InChI=1S/C11H14F3N/c12-11(13,14)8-9-4-3-5-10(9)15-6-1-2-7-15/h5,8H,1-4,6-7H2/b9-8+ |
| InChIKey | ZTFLNTRCWQFOOV-CMDGGOBGSA-N |
| XLogP | 3.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[(5E)-5-(2,2,2-trifluoroethylidene)cyclopenten-1-yl]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5E)-5-(2,2,2-trifluoroethylidene)cyclopenten-1-yl]pyrrolidine?
The IUPAC name of 1-[(5E)-5-(2,2,2-trifluoroethylidene)cyclopenten-1-yl]pyrrolidine (CID 164806139) is 1-[(5E)-5-(2,2,2-trifluoroethylidene)cyclopenten-1-yl]pyrrolidine.
What is the SMILES notation for 1-[(5E)-5-(2,2,2-trifluoroethylidene)cyclopenten-1-yl]pyrrolidine?
The canonical SMILES for 1-[(5E)-5-(2,2,2-trifluoroethylidene)cyclopenten-1-yl]pyrrolidine is FC(F)(F)/C=C1\CCC=C1N1CCCC1.
What is the InChIKey of 1-[(5E)-5-(2,2,2-trifluoroethylidene)cyclopenten-1-yl]pyrrolidine?
The InChIKey is ZTFLNTRCWQFOOV-CMDGGOBGSA-N. The full InChI is InChI=1S/C11H14F3N/c12-11(13,14)8-9-4-3-5-10(9)15-6-1-2-7-15/h5,8H,1-4,6-7H2/b9-8+.
What are the key properties of 1-[(5E)-5-(2,2,2-trifluoroethylidene)cyclopenten-1-yl]pyrrolidine?
1-[(5E)-5-(2,2,2-trifluoroethylidene)cyclopenten-1-yl]pyrrolidine has a molecular weight of 217.23 g/mol, XLogP of 3.25, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5E)-5-(2,2,2-trifluoroethylidene)cyclopenten-1-yl]pyrrolidine is sourced from PubChem (CID 164806139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).