About 3-(3,3-difluoropyrrolidin-1-ium-1-carbonyl)-1H-pyridin-4-one
3-(3,3-difluoropyrrolidin-1-ium-1-carbonyl)-1H-pyridin-4-one (PubChem CID 164806287) has the molecular formula C10H11F2N2O2+
and a molecular weight of 229.21 g/mol. Its IUPAC name is 3-(3,3-difluoropyrrolidin-1-ium-1-carbonyl)-1H-pyridin-4-one.
Molecular Properties
| Compound Name | 3-(3,3-difluoropyrrolidin-1-ium-1-carbonyl)-1H-pyridin-4-one |
| PubChem CID | 164806287 |
| Molecular Formula | C10H11F2N2O2+ |
| Molecular Weight | 229.21 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | 3-(3,3-difluoropyrrolidin-1-ium-1-carbonyl)-1H-pyridin-4-one |
| SMILES | O=C(c1c[nH]ccc1=O)[NH+]1CCC(F)(F)C1 |
| InChI | InChI=1S/C10H10F2N2O2/c11-10(12)2-4-14(6-10)9(16)7-5-13-3-1-8(7)15/h1,3,5H,2,4,6H2,(H,13,15)/p+1 |
| InChIKey | AETTYKSOXLEJQI-UHFFFAOYSA-O |
| XLogP | -0.56 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.21 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(3,3-difluoropyrrolidin-1-ium-1-carbonyl)-1H-pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,3-difluoropyrrolidin-1-ium-1-carbonyl)-1H-pyridin-4-one?
The IUPAC name of 3-(3,3-difluoropyrrolidin-1-ium-1-carbonyl)-1H-pyridin-4-one (CID 164806287) is 3-(3,3-difluoropyrrolidin-1-ium-1-carbonyl)-1H-pyridin-4-one.
What is the SMILES notation for 3-(3,3-difluoropyrrolidin-1-ium-1-carbonyl)-1H-pyridin-4-one?
The canonical SMILES for 3-(3,3-difluoropyrrolidin-1-ium-1-carbonyl)-1H-pyridin-4-one is O=C(c1c[nH]ccc1=O)[NH+]1CCC(F)(F)C1.
What is the InChIKey of 3-(3,3-difluoropyrrolidin-1-ium-1-carbonyl)-1H-pyridin-4-one?
The InChIKey is AETTYKSOXLEJQI-UHFFFAOYSA-O. The full InChI is InChI=1S/C10H10F2N2O2/c11-10(12)2-4-14(6-10)9(16)7-5-13-3-1-8(7)15/h1,3,5H,2,4,6H2,(H,13,15)/p+1.
What are the key properties of 3-(3,3-difluoropyrrolidin-1-ium-1-carbonyl)-1H-pyridin-4-one?
3-(3,3-difluoropyrrolidin-1-ium-1-carbonyl)-1H-pyridin-4-one has a molecular weight of 229.21 g/mol, XLogP of -0.56, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,3-difluoropyrrolidin-1-ium-1-carbonyl)-1H-pyridin-4-one is sourced from PubChem (CID 164806287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).