C29H46BCl2NO5SSi — CID 164806366
N-[(1R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-7,7-dichloro-6-oxo-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]heptyl]-2-thiophen-2-ylacetamide (PubChem CID 164806366) has the molecular formula C29H46BCl2NO5SSi and a molecular weight of 630.56 g/mol. Its IUPAC name is N-[(1R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-7,7-dichloro-6-oxo-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]heptyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[(1R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-7,7-dichloro-6-oxo-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]heptyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 164806366 |
| Molecular Formula | C29H46BCl2NO5SSi |
| Molecular Weight | 630.56 g/mol |
| Exact Mass | 629.23 |
| IUPAC Name | N-[(1R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-7,7-dichloro-6-oxo-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]heptyl]-2-thiophen-2-ylacetamide |
| SMILES | CC1(C)[C@@H]2C[C@H]3OB([C@H](CC[C@@H](CC(=O)C(Cl)Cl)O[Si](C)(C)C(C)(C)C)NC(=O)Cc4cccs4)O[C@@]3(C)[C@H]1C2 |
| InChI | InChI=1S/C29H46BCl2NO5SSi/c1-27(2,3)40(7,8)37-19(16-21(34)26(31)32)11-12-24(33-25(35)17-20-10-9-13-39-20)30-36-23-15-18-14-22(28(18,4)5)29(23,6)38-30/h9-10,13,18-19,22-24,26H,11-12,14-17H2,1-8H3,(H,33,35)/t18-,19-,22-,23+,24-,29-/m0/s1 |
| InChIKey | CNDPNASVIABYMZ-DFDUXADSSA-N |
| XLogP | 6.98 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.56 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|