C15H10IN — CID 164806532
14-iodo-5-azatricyclo[10.4.0.04,9]hexadeca-1(12),4(9),5,7,13,15-hexaen-2-yne (PubChem CID 164806532) has the molecular formula C15H10IN and a molecular weight of 331.16 g/mol. Its IUPAC name is 14-iodo-5-azatricyclo[10.4.0.04,9]hexadeca-1(12),4(9),5,7,13,15-hexaen-2-yne.
| Compound Name | 14-iodo-5-azatricyclo[10.4.0.04,9]hexadeca-1(12),4(9),5,7,13,15-hexaen-2-yne |
|---|---|
| PubChem CID | 164806532 |
| Molecular Formula | C15H10IN |
| Molecular Weight | 331.16 g/mol |
| Exact Mass | 330.99 |
| IUPAC Name | 14-iodo-5-azatricyclo[10.4.0.04,9]hexadeca-1(12),4(9),5,7,13,15-hexaen-2-yne |
| SMILES | Ic1ccc2c(c1)CCc1cccnc1C#C2 |
| InChI | InChI=1S/C15H10IN/c16-14-7-5-11-6-8-15-12(2-1-9-17-15)3-4-13(11)10-14/h1-2,5,7,9-10H,3-4H2 |
| InChIKey | AHKQPMCARPEDOW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.16 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|