About N-(2,3-dichlorophenyl)-N-phenyl-6-(trideuteriomethyl)furo[2,3-b]pyridin-3-amine
N-(2,3-dichlorophenyl)-N-phenyl-6-(trideuteriomethyl)furo[2,3-b]pyridin-3-amine (PubChem CID 164806667) has the molecular formula C20H14Cl2N2O
and a molecular weight of 372.27 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-N-phenyl-6-(trideuteriomethyl)furo[2,3-b]pyridin-3-amine.
Molecular Properties
| Compound Name | N-(2,3-dichlorophenyl)-N-phenyl-6-(trideuteriomethyl)furo[2,3-b]pyridin-3-amine |
| PubChem CID | 164806667 |
| Molecular Formula | C20H14Cl2N2O |
| Molecular Weight | 372.27 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | N-(2,3-dichlorophenyl)-N-phenyl-6-(trideuteriomethyl)furo[2,3-b]pyridin-3-amine |
| SMILES | [2H]C([2H])([2H])c1ccc2c(N(c3ccccc3)c3cccc(Cl)c3Cl)coc2n1 |
| InChI | InChI=1S/C20H14Cl2N2O/c1-13-10-11-15-18(12-25-20(15)23-13)24(14-6-3-2-4-7-14)17-9-5-8-16(21)19(17)22/h2-12H,1H3/i1D3 |
| InChIKey | NWAQVXBKVBGBLN-FIBGUPNXSA-N |
| XLogP | 6.91 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.27 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2,3-dichlorophenyl)-N-phenyl-6-(trideuteriomethyl)furo[2,3-b]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,3-dichlorophenyl)-N-phenyl-6-(trideuteriomethyl)furo[2,3-b]pyridin-3-amine?
The IUPAC name of N-(2,3-dichlorophenyl)-N-phenyl-6-(trideuteriomethyl)furo[2,3-b]pyridin-3-amine (CID 164806667) is N-(2,3-dichlorophenyl)-N-phenyl-6-(trideuteriomethyl)furo[2,3-b]pyridin-3-amine.
What is the SMILES notation for N-(2,3-dichlorophenyl)-N-phenyl-6-(trideuteriomethyl)furo[2,3-b]pyridin-3-amine?
The canonical SMILES for N-(2,3-dichlorophenyl)-N-phenyl-6-(trideuteriomethyl)furo[2,3-b]pyridin-3-amine is [2H]C([2H])([2H])c1ccc2c(N(c3ccccc3)c3cccc(Cl)c3Cl)coc2n1.
What is the InChIKey of N-(2,3-dichlorophenyl)-N-phenyl-6-(trideuteriomethyl)furo[2,3-b]pyridin-3-amine?
The InChIKey is NWAQVXBKVBGBLN-FIBGUPNXSA-N. The full InChI is InChI=1S/C20H14Cl2N2O/c1-13-10-11-15-18(12-25-20(15)23-13)24(14-6-3-2-4-7-14)17-9-5-8-16(21)19(17)22/h2-12H,1H3/i1D3.
What are the key properties of N-(2,3-dichlorophenyl)-N-phenyl-6-(trideuteriomethyl)furo[2,3-b]pyridin-3-amine?
N-(2,3-dichlorophenyl)-N-phenyl-6-(trideuteriomethyl)furo[2,3-b]pyridin-3-amine has a molecular weight of 372.27 g/mol, XLogP of 6.91, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,3-dichlorophenyl)-N-phenyl-6-(trideuteriomethyl)furo[2,3-b]pyridin-3-amine is sourced from PubChem (CID 164806667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).