C30H27BO3 — CID 164808595
4,4,5,5-tetramethyl-2-[6-(3-phenylphenyl)dibenzofuran-1-yl]-1,3,2-dioxaborolane (PubChem CID 164808595) has the molecular formula C30H27BO3 and a molecular weight of 446.36 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[6-(3-phenylphenyl)dibenzofuran-1-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[6-(3-phenylphenyl)dibenzofuran-1-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 164808595 |
| Molecular Formula | C30H27BO3 |
| Molecular Weight | 446.36 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[6-(3-phenylphenyl)dibenzofuran-1-yl]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2cccc3oc4c(-c5cccc(-c6ccccc6)c5)cccc4c23)OC1(C)C |
| InChI | InChI=1S/C30H27BO3/c1-29(2)30(3,4)34-31(33-29)25-17-10-18-26-27(25)24-16-9-15-23(28(24)32-26)22-14-8-13-21(19-22)20-11-6-5-7-12-20/h5-19H,1-4H3 |
| InChIKey | ICZNIHYIWIQGRA-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.36 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|